C21H18Cl2N2O — CID 51357605
3,6-bis(4-chlorophenyl)-4-pyridin-3-yl-1,3-oxazinane (PubChem CID 51357605) has the molecular formula C21H18Cl2N2O and a molecular weight of 385.29 g/mol. Its IUPAC name is 3,6-bis(4-chlorophenyl)-4-pyridin-3-yl-1,3-oxazinane.
| Compound Name | 3,6-bis(4-chlorophenyl)-4-pyridin-3-yl-1,3-oxazinane |
|---|---|
| PubChem CID | 51357605 |
| Molecular Formula | C21H18Cl2N2O |
| Molecular Weight | 385.29 g/mol |
| Exact Mass | 384.08 |
| IUPAC Name | 3,6-bis(4-chlorophenyl)-4-pyridin-3-yl-1,3-oxazinane |
| SMILES | Clc1ccc(C2CC(c3cccnc3)N(c3ccc(Cl)cc3)CO2)cc1 |
| InChI | InChI=1S/C21H18Cl2N2O/c22-17-5-3-15(4-6-17)21-12-20(16-2-1-11-24-13-16)25(14-26-21)19-9-7-18(23)8-10-19/h1-11,13,20-21H,12,14H2 |
| InChIKey | XWXDEWPMBCNSHV-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.29 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |