C21H35N3O2S — CID 51360660
4-(4-hexylpiperazin-1-yl)-2-(2-phenylethyl)-1,2-thiazolidine 1,1-dioxide (PubChem CID 51360660) has the molecular formula C21H35N3O2S and a molecular weight of 393.60 g/mol. Its IUPAC name is 4-(4-hexylpiperazin-1-yl)-2-(2-phenylethyl)-1,2-thiazolidine 1,1-dioxide.
| Compound Name | 4-(4-hexylpiperazin-1-yl)-2-(2-phenylethyl)-1,2-thiazolidine 1,1-dioxide |
|---|---|
| PubChem CID | 51360660 |
| Molecular Formula | C21H35N3O2S |
| Molecular Weight | 393.60 g/mol |
| Exact Mass | 393.24 |
| IUPAC Name | 4-(4-hexylpiperazin-1-yl)-2-(2-phenylethyl)-1,2-thiazolidine 1,1-dioxide |
| SMILES | CCCCCCN1CCN(C2CN(CCc3ccccc3)S(=O)(=O)C2)CC1 |
| InChI | InChI=1S/C21H35N3O2S/c1-2-3-4-8-12-22-14-16-23(17-15-22)21-18-24(27(25,26)19-21)13-11-20-9-6-5-7-10-20/h5-7,9-10,21H,2-4,8,11-19H2,1H3 |
| InChIKey | LHTJATDAZULNRX-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.60 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|