C19H15BrFN3OS — CID 51365089
N-(3-bromophenyl)-2-[2-(3-fluorophenyl)-6-methylpyrimidin-4-yl]sulfanylacetamide (PubChem CID 51365089) has the molecular formula C19H15BrFN3OS and a molecular weight of 432.32 g/mol. Its IUPAC name is N-(3-bromophenyl)-2-[2-(3-fluorophenyl)-6-methylpyrimidin-4-yl]sulfanylacetamide.
| Compound Name | N-(3-bromophenyl)-2-[2-(3-fluorophenyl)-6-methylpyrimidin-4-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 51365089 |
| Molecular Formula | C19H15BrFN3OS |
| Molecular Weight | 432.32 g/mol |
| Exact Mass | 431.01 |
| IUPAC Name | N-(3-bromophenyl)-2-[2-(3-fluorophenyl)-6-methylpyrimidin-4-yl]sulfanylacetamide |
| SMILES | Cc1cc(SCC(=O)Nc2cccc(Br)c2)nc(-c2cccc(F)c2)n1 |
| InChI | InChI=1S/C19H15BrFN3OS/c1-12-8-18(24-19(22-12)13-4-2-6-15(21)9-13)26-11-17(25)23-16-7-3-5-14(20)10-16/h2-10H,11H2,1H3,(H,23,25) |
| InChIKey | FIMPVRLYOVXFLI-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.32 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |