C22H22FN3OS — CID 51365063
2-[2-(3-fluorophenyl)-6-methylpyrimidin-4-yl]sulfanyl-N-(4-propan-2-ylphenyl)acetamide (PubChem CID 51365063) has the molecular formula C22H22FN3OS and a molecular weight of 395.50 g/mol. Its IUPAC name is 2-[2-(3-fluorophenyl)-6-methylpyrimidin-4-yl]sulfanyl-N-(4-propan-2-ylphenyl)acetamide.
| Compound Name | 2-[2-(3-fluorophenyl)-6-methylpyrimidin-4-yl]sulfanyl-N-(4-propan-2-ylphenyl)acetamide |
|---|---|
| PubChem CID | 51365063 |
| Molecular Formula | C22H22FN3OS |
| Molecular Weight | 395.50 g/mol |
| Exact Mass | 395.15 |
| IUPAC Name | 2-[2-(3-fluorophenyl)-6-methylpyrimidin-4-yl]sulfanyl-N-(4-propan-2-ylphenyl)acetamide |
| SMILES | Cc1cc(SCC(=O)Nc2ccc(C(C)C)cc2)nc(-c2cccc(F)c2)n1 |
| InChI | InChI=1S/C22H22FN3OS/c1-14(2)16-7-9-19(10-8-16)25-20(27)13-28-21-11-15(3)24-22(26-21)17-5-4-6-18(23)12-17/h4-12,14H,13H2,1-3H3,(H,25,27) |
| InChIKey | LSCUZTMIHIFORL-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.50 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |