C19H14Cl2N2OS — CID 95921658
1-(4-chlorophenyl)-2-[2-(3-chlorophenyl)-6-methylpyrimidin-4-yl]sulfanylethanone (PubChem CID 95921658) has the molecular formula C19H14Cl2N2OS and a molecular weight of 389.31 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-2-[2-(3-chlorophenyl)-6-methylpyrimidin-4-yl]sulfanylethanone.
| Compound Name | 1-(4-chlorophenyl)-2-[2-(3-chlorophenyl)-6-methylpyrimidin-4-yl]sulfanylethanone |
|---|---|
| PubChem CID | 95921658 |
| Molecular Formula | C19H14Cl2N2OS |
| Molecular Weight | 389.31 g/mol |
| Exact Mass | 388.02 |
| IUPAC Name | 1-(4-chlorophenyl)-2-[2-(3-chlorophenyl)-6-methylpyrimidin-4-yl]sulfanylethanone |
| SMILES | Cc1cc(SCC(=O)c2ccc(Cl)cc2)nc(-c2cccc(Cl)c2)n1 |
| InChI | InChI=1S/C19H14Cl2N2OS/c1-12-9-18(23-19(22-12)14-3-2-4-16(21)10-14)25-11-17(24)13-5-7-15(20)8-6-13/h2-10H,11H2,1H3 |
| InChIKey | DXOOZAHMQIXESD-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.31 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |