C16H16N2O3S2 — CID 22299989
2-[6-methyl-2-[2-(4-methylphenyl)-2-oxoethyl]sulfanylpyrimidin-4-yl]sulfanylacetic acid (PubChem CID 22299989) has the molecular formula C16H16N2O3S2 and a molecular weight of 348.45 g/mol. Its IUPAC name is 2-[6-methyl-2-[2-(4-methylphenyl)-2-oxoethyl]sulfanylpyrimidin-4-yl]sulfanylacetic acid.
| Compound Name | 2-[6-methyl-2-[2-(4-methylphenyl)-2-oxoethyl]sulfanylpyrimidin-4-yl]sulfanylacetic acid |
|---|---|
| PubChem CID | 22299989 |
| Molecular Formula | C16H16N2O3S2 |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.06 |
| IUPAC Name | 2-[6-methyl-2-[2-(4-methylphenyl)-2-oxoethyl]sulfanylpyrimidin-4-yl]sulfanylacetic acid |
| SMILES | Cc1ccc(C(=O)CSc2nc(C)cc(SCC(=O)O)n2)cc1 |
| InChI | InChI=1S/C16H16N2O3S2/c1-10-3-5-12(6-4-10)13(19)8-23-16-17-11(2)7-14(18-16)22-9-15(20)21/h3-7H,8-9H2,1-2H3,(H,20,21) |
| InChIKey | GNVQAZNOUSKHHV-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 80.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |