C19H18N2O5 — CID 51370461
2-(2,4-dimethoxyphenyl)imino-8-methoxychromene-3-carboxamide (PubChem CID 51370461) has the molecular formula C19H18N2O5 and a molecular weight of 354.36 g/mol. Its IUPAC name is 2-(2,4-dimethoxyphenyl)imino-8-methoxychromene-3-carboxamide.
| Compound Name | 2-(2,4-dimethoxyphenyl)imino-8-methoxychromene-3-carboxamide |
|---|---|
| PubChem CID | 51370461 |
| Molecular Formula | C19H18N2O5 |
| Molecular Weight | 354.36 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | 2-(2,4-dimethoxyphenyl)imino-8-methoxychromene-3-carboxamide |
| SMILES | COc1ccc(/N=c2\oc3c(OC)cccc3cc2C(N)=O)c(OC)c1 |
| InChI | InChI=1S/C19H18N2O5/c1-23-12-7-8-14(16(10-12)25-3)21-19-13(18(20)22)9-11-5-4-6-15(24-2)17(11)26-19/h4-10H,1-3H3,(H2,20,22)/b21-19- |
| InChIKey | SQYBTRUFXVZASA-VZCXRCSSSA-N |
| XLogP | 2.79 |
| TPSA | 96.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.36 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |