C22H22N2O4 — CID 51370925
(E)-3-(5-methoxy-1-benzofuran-2-yl)-N-(4-morpholin-4-ylphenyl)prop-2-enamide (PubChem CID 51370925) has the molecular formula C22H22N2O4 and a molecular weight of 378.43 g/mol. Its IUPAC name is (E)-3-(5-methoxy-1-benzofuran-2-yl)-N-(4-morpholin-4-ylphenyl)prop-2-enamide.
| Compound Name | (E)-3-(5-methoxy-1-benzofuran-2-yl)-N-(4-morpholin-4-ylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 51370925 |
| Molecular Formula | C22H22N2O4 |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.16 |
| IUPAC Name | (E)-3-(5-methoxy-1-benzofuran-2-yl)-N-(4-morpholin-4-ylphenyl)prop-2-enamide |
| SMILES | COc1ccc2oc(/C=C/C(=O)Nc3ccc(N4CCOCC4)cc3)cc2c1 |
| InChI | InChI=1S/C22H22N2O4/c1-26-19-6-8-21-16(14-19)15-20(28-21)7-9-22(25)23-17-2-4-18(5-3-17)24-10-12-27-13-11-24/h2-9,14-15H,10-13H2,1H3,(H,23,25)/b9-7+ |
| InChIKey | ZAKAARBCGOIKMY-VQHVLOKHSA-N |
| XLogP | 3.93 |
| TPSA | 63.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|