C14H15N3 — CID 51371056
N-phenyl-5,6,7,8-tetrahydroquinazolin-2-amine (PubChem CID 51371056) has the molecular formula C14H15N3 and a molecular weight of 225.30 g/mol. Its IUPAC name is N-phenyl-5,6,7,8-tetrahydroquinazolin-2-amine.
| Compound Name | N-phenyl-5,6,7,8-tetrahydroquinazolin-2-amine |
|---|---|
| PubChem CID | 51371056 |
| Molecular Formula | C14H15N3 |
| Molecular Weight | 225.30 g/mol |
| Exact Mass | 225.13 |
| IUPAC Name | N-phenyl-5,6,7,8-tetrahydroquinazolin-2-amine |
| SMILES | c1ccc(Nc2ncc3c(n2)CCCC3)cc1 |
| InChI | InChI=1S/C14H15N3/c1-2-7-12(8-3-1)16-14-15-10-11-6-4-5-9-13(11)17-14/h1-3,7-8,10H,4-6,9H2,(H,15,16,17) |
| InChIKey | CDYAOTQTBFPDQP-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.30 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |