C19H16F3NO3 — CID 5137244
2-[5-methoxy-7-methyl-2-[4-(trifluoromethyl)phenyl]-1H-indol-3-yl]acetic acid (PubChem CID 5137244) has the molecular formula C19H16F3NO3 and a molecular weight of 363.34 g/mol. Its IUPAC name is 2-[5-methoxy-7-methyl-2-[4-(trifluoromethyl)phenyl]-1H-indol-3-yl]acetic acid.
| Compound Name | 2-[5-methoxy-7-methyl-2-[4-(trifluoromethyl)phenyl]-1H-indol-3-yl]acetic acid |
|---|---|
| PubChem CID | 5137244 |
| Molecular Formula | C19H16F3NO3 |
| Molecular Weight | 363.34 g/mol |
| Exact Mass | 363.11 |
| IUPAC Name | 2-[5-methoxy-7-methyl-2-[4-(trifluoromethyl)phenyl]-1H-indol-3-yl]acetic acid |
| SMILES | COc1cc(C)c2[nH]c(-c3ccc(C(F)(F)F)cc3)c(CC(=O)O)c2c1 |
| InChI | InChI=1S/C19H16F3NO3/c1-10-7-13(26-2)8-14-15(9-16(24)25)18(23-17(10)14)11-3-5-12(6-4-11)19(20,21)22/h3-8,23H,9H2,1-2H3,(H,24,25) |
| InChIKey | MNNMCRZQHLZPCT-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 62.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.34 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |