C21H23FN6O4S — CID 5139083
4-methyl-3-[[4-[3-(2,4,6-triaminopyrimidin-5-yl)propoxy]phenyl]carbamoyl]benzenesulfonyl fluoride (PubChem CID 5139083) has the molecular formula C21H23FN6O4S and a molecular weight of 474.52 g/mol. Its IUPAC name is 4-methyl-3-[[4-[3-(2,4,6-triaminopyrimidin-5-yl)propoxy]phenyl]carbamoyl]benzenesulfonyl fluoride.
| Compound Name | 4-methyl-3-[[4-[3-(2,4,6-triaminopyrimidin-5-yl)propoxy]phenyl]carbamoyl]benzenesulfonyl fluoride |
|---|---|
| PubChem CID | 5139083 |
| Molecular Formula | C21H23FN6O4S |
| Molecular Weight | 474.52 g/mol |
| Exact Mass | 474.15 |
| IUPAC Name | 4-methyl-3-[[4-[3-(2,4,6-triaminopyrimidin-5-yl)propoxy]phenyl]carbamoyl]benzenesulfonyl fluoride |
| SMILES | Cc1ccc(S(=O)(=O)F)cc1C(=O)Nc1ccc(OCCCc2c(N)nc(N)nc2N)cc1 |
| InChI | InChI=1S/C21H23FN6O4S/c1-12-4-9-15(33(22,30)31)11-17(12)20(29)26-13-5-7-14(8-6-13)32-10-2-3-16-18(23)27-21(25)28-19(16)24/h4-9,11H,2-3,10H2,1H3,(H,26,29)(H6,23,24,25,27,28) |
| InChIKey | MLQRJUSJUOXTME-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 176.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.52 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|