C21H25FN6O8S2 — CID 54607106
2-methyl-5-[[4-[3-(2,4,6-triaminopyrimidin-5-yl)propoxy]phenyl]carbamoyl]benzenesulfonyl fluoride;sulfuric acid (PubChem CID 54607106) has the molecular formula C21H25FN6O8S2 and a molecular weight of 572.60 g/mol. Its IUPAC name is 2-methyl-5-[[4-[3-(2,4,6-triaminopyrimidin-5-yl)propoxy]phenyl]carbamoyl]benzenesulfonyl fluoride;sulfuric acid.
| Compound Name | 2-methyl-5-[[4-[3-(2,4,6-triaminopyrimidin-5-yl)propoxy]phenyl]carbamoyl]benzenesulfonyl fluoride;sulfuric acid |
|---|---|
| PubChem CID | 54607106 |
| Molecular Formula | C21H25FN6O8S2 |
| Molecular Weight | 572.60 g/mol |
| Exact Mass | 572.12 |
| IUPAC Name | 2-methyl-5-[[4-[3-(2,4,6-triaminopyrimidin-5-yl)propoxy]phenyl]carbamoyl]benzenesulfonyl fluoride;sulfuric acid |
| SMILES | Cc1ccc(C(=O)Nc2ccc(OCCCc3c(N)nc(N)nc3N)cc2)cc1S(=O)(=O)F.O=S(=O)(O)O |
| InChI | InChI=1S/C21H23FN6O4S.H2O4S/c1-12-4-5-13(11-17(12)33(22,30)31)20(29)26-14-6-8-15(9-7-14)32-10-2-3-16-18(23)27-21(25)28-19(16)24;1-5(2,3)4/h4-9,11H,2-3,10H2,1H3,(H,26,29)(H6,23,24,25,27,28);(H2,1,2,3,4) |
| InChIKey | TVZNXDBXSOFWKB-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 250.91 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.60 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|