C22H34N2O2S2 — CID 51393856
ethyl (6S)-6-tert-butyl-2-(cyclohexylcarbamothioylamino)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 51393856) has the molecular formula C22H34N2O2S2 and a molecular weight of 422.66 g/mol. Its IUPAC name is ethyl (6S)-6-tert-butyl-2-(cyclohexylcarbamothioylamino)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | ethyl (6S)-6-tert-butyl-2-(cyclohexylcarbamothioylamino)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 51393856 |
| Molecular Formula | C22H34N2O2S2 |
| Molecular Weight | 422.66 g/mol |
| Exact Mass | 422.21 |
| IUPAC Name | ethyl (6S)-6-tert-butyl-2-(cyclohexylcarbamothioylamino)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=S)NC2CCCCC2)sc2c1CC[C@H](C(C)(C)C)C2 |
| InChI | InChI=1S/C22H34N2O2S2/c1-5-26-20(25)18-16-12-11-14(22(2,3)4)13-17(16)28-19(18)24-21(27)23-15-9-7-6-8-10-15/h14-15H,5-13H2,1-4H3,(H2,23,24,27)/t14-/m0/s1 |
| InChIKey | AJIDBNHBEZWQGI-AWEZNQCLSA-N |
| XLogP | 5.69 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.66 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|