C39H31F5N2O6S — CID 5139981
2-[[6-[4-(hydroxymethyl)phenyl]-5-methyl-2-[4-[2-[[(2,3,4,5,6-pentafluorobenzoyl)amino]methyl]phenyl]phenyl]-1,3-dioxan-4-yl]methylsulfanyl]pyridine-3-carboxylic acid (PubChem CID 5139981) has the molecular formula C39H31F5N2O6S and a molecular weight of 750.74 g/mol. Its IUPAC name is 2-[[6-[4-(hydroxymethyl)phenyl]-5-methyl-2-[4-[2-[[(2,3,4,5,6-pentafluorobenzoyl)amino]methyl]phenyl]phenyl]-1,3-dioxan-4-yl]methylsulfanyl]pyridine-3-carboxylic acid.
| Compound Name | 2-[[6-[4-(hydroxymethyl)phenyl]-5-methyl-2-[4-[2-[[(2,3,4,5,6-pentafluorobenzoyl)amino]methyl]phenyl]phenyl]-1,3-dioxan-4-yl]methylsulfanyl]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 5139981 |
| Molecular Formula | C39H31F5N2O6S |
| Molecular Weight | 750.74 g/mol |
| Exact Mass | 750.18 |
| IUPAC Name | 2-[[6-[4-(hydroxymethyl)phenyl]-5-methyl-2-[4-[2-[[(2,3,4,5,6-pentafluorobenzoyl)amino]methyl]phenyl]phenyl]-1,3-dioxan-4-yl]methylsulfanyl]pyridine-3-carboxylic acid |
| SMILES | CC1C(CSc2ncccc2C(=O)O)OC(c2ccc(-c3ccccc3CNC(=O)c3c(F)c(F)c(F)c(F)c3F)cc2)OC1c1ccc(CO)cc1 |
| InChI | InChI=1S/C39H31F5N2O6S/c1-20-28(19-53-37-27(38(49)50)7-4-16-45-37)51-39(52-35(20)23-10-8-21(18-47)9-11-23)24-14-12-22(13-15-24)26-6-3-2-5-25(26)17-46-36(48)29-30(40)32(42)34(44)33(43)31(29)41/h2-16,20,28,35,39,47H,17-19H2,1H3,(H,46,48)(H,49,50) |
| InChIKey | IQFJWYTWIFYBBQ-UHFFFAOYSA-N |
| XLogP | 8.15 |
| TPSA | 117.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 750.74 |
| LogP ≤ 5 | 8.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|