C13H23NO — CID 51405756
(NE)-N-[1-[(1S,2R,4R)-4,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]propylidene]hydroxylamine (PubChem CID 51405756) has the molecular formula C13H23NO and a molecular weight of 209.33 g/mol. Its IUPAC name is (NE)-N-[1-[(1S,2R,4R)-4,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]propylidene]hydroxylamine.
| Compound Name | (NE)-N-[1-[(1S,2R,4R)-4,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]propylidene]hydroxylamine |
|---|---|
| PubChem CID | 51405756 |
| Molecular Formula | C13H23NO |
| Molecular Weight | 209.33 g/mol |
| Exact Mass | 209.18 |
| IUPAC Name | (NE)-N-[1-[(1S,2R,4R)-4,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]propylidene]hydroxylamine |
| SMILES | CC/C(=N\O)[C@@H]1C[C@@]2(C)CC[C@@H]1C2(C)C |
| InChI | InChI=1S/C13H23NO/c1-5-11(14-15)9-8-13(4)7-6-10(9)12(13,2)3/h9-10,15H,5-8H2,1-4H3/b14-11+/t9-,10+,13-/m1/s1 |
| InChIKey | SXFVEWCGZCOGMN-IRVUEHAHSA-N |
| XLogP | 3.69 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.33 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|