C27H33NO7 — CID 51406676
3-O-cyclopentyl 6-O-methyl (4S,6R,7S)-4-(2,4-dimethoxyphenyl)-2,7-dimethyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3,6-dicarboxylate (PubChem CID 51406676) has the molecular formula C27H33NO7 and a molecular weight of 483.56 g/mol. Its IUPAC name is 3-O-cyclopentyl 6-O-methyl (4S,6R,7S)-4-(2,4-dimethoxyphenyl)-2,7-dimethyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3,6-dicarboxylate.
| Compound Name | 3-O-cyclopentyl 6-O-methyl (4S,6R,7S)-4-(2,4-dimethoxyphenyl)-2,7-dimethyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3,6-dicarboxylate |
|---|---|
| PubChem CID | 51406676 |
| Molecular Formula | C27H33NO7 |
| Molecular Weight | 483.56 g/mol |
| Exact Mass | 483.23 |
| IUPAC Name | 3-O-cyclopentyl 6-O-methyl (4S,6R,7S)-4-(2,4-dimethoxyphenyl)-2,7-dimethyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3,6-dicarboxylate |
| SMILES | COC(=O)[C@H]1C(=O)C2=C(C[C@@H]1C)NC(C)=C(C(=O)OC1CCCC1)[C@H]2c1ccc(OC)cc1OC |
| InChI | InChI=1S/C27H33NO7/c1-14-12-19-24(25(29)21(14)26(30)34-5)23(18-11-10-17(32-3)13-20(18)33-4)22(15(2)28-19)27(31)35-16-8-6-7-9-16/h10-11,13-14,16,21,23,28H,6-9,12H2,1-5H3/t14-,21+,23+/m0/s1 |
| InChIKey | MMUKTECHWONOGB-NNIZRDCOSA-N |
| XLogP | 3.80 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.56 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|