C26H31NO6 — CID 51407135
3-O-cyclopentyl 6-O-methyl (4S,6R,7S)-4-(3-methoxyphenyl)-2,7-dimethyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3,6-dicarboxylate (PubChem CID 51407135) has the molecular formula C26H31NO6 and a molecular weight of 453.54 g/mol. Its IUPAC name is 3-O-cyclopentyl 6-O-methyl (4S,6R,7S)-4-(3-methoxyphenyl)-2,7-dimethyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3,6-dicarboxylate.
| Compound Name | 3-O-cyclopentyl 6-O-methyl (4S,6R,7S)-4-(3-methoxyphenyl)-2,7-dimethyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3,6-dicarboxylate |
|---|---|
| PubChem CID | 51407135 |
| Molecular Formula | C26H31NO6 |
| Molecular Weight | 453.54 g/mol |
| Exact Mass | 453.22 |
| IUPAC Name | 3-O-cyclopentyl 6-O-methyl (4S,6R,7S)-4-(3-methoxyphenyl)-2,7-dimethyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3,6-dicarboxylate |
| SMILES | COC(=O)[C@H]1C(=O)C2=C(C[C@@H]1C)NC(C)=C(C(=O)OC1CCCC1)[C@H]2c1cccc(OC)c1 |
| InChI | InChI=1S/C26H31NO6/c1-14-12-19-23(24(28)20(14)25(29)32-4)22(16-8-7-11-18(13-16)31-3)21(15(2)27-19)26(30)33-17-9-5-6-10-17/h7-8,11,13-14,17,20,22,27H,5-6,9-10,12H2,1-4H3/t14-,20+,22+/m0/s1 |
| InChIKey | RMEHWUIGLUBYCG-UPNLOYSTSA-N |
| XLogP | 3.79 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.54 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|