C24H25N3O2 — CID 51408244
(4S,7S)-2,7-dimethyl-4-(2-methylphenyl)-5-oxo-N-pyridin-2-yl-4,6,7,8-tetrahydro-1H-quinoline-3-carboxamide (PubChem CID 51408244) has the molecular formula C24H25N3O2 and a molecular weight of 387.48 g/mol. Its IUPAC name is (4S,7S)-2,7-dimethyl-4-(2-methylphenyl)-5-oxo-N-pyridin-2-yl-4,6,7,8-tetrahydro-1H-quinoline-3-carboxamide.
| Compound Name | (4S,7S)-2,7-dimethyl-4-(2-methylphenyl)-5-oxo-N-pyridin-2-yl-4,6,7,8-tetrahydro-1H-quinoline-3-carboxamide |
|---|---|
| PubChem CID | 51408244 |
| Molecular Formula | C24H25N3O2 |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.19 |
| IUPAC Name | (4S,7S)-2,7-dimethyl-4-(2-methylphenyl)-5-oxo-N-pyridin-2-yl-4,6,7,8-tetrahydro-1H-quinoline-3-carboxamide |
| SMILES | CC1=C(C(=O)Nc2ccccn2)[C@@H](c2ccccc2C)C2=C(C[C@H](C)CC2=O)N1 |
| InChI | InChI=1S/C24H25N3O2/c1-14-12-18-23(19(28)13-14)22(17-9-5-4-8-15(17)2)21(16(3)26-18)24(29)27-20-10-6-7-11-25-20/h4-11,14,22,26H,12-13H2,1-3H3,(H,25,27,29)/t14-,22+/m0/s1 |
| InChIKey | GLOLWJBZHYMUIN-RCDICMHDSA-N |
| XLogP | 4.24 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |