C25H27N3O2 — CID 51650072
(4R,7R)-2,7-dimethyl-4-(2-methylphenyl)-N-(5-methyl-2-pyridinyl)-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxamide (PubChem CID 51650072) has the molecular formula C25H27N3O2 and a molecular weight of 401.51 g/mol. Its IUPAC name is (4R,7R)-2,7-dimethyl-4-(2-methylphenyl)-N-(5-methyl-2-pyridinyl)-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxamide.
| Compound Name | (4R,7R)-2,7-dimethyl-4-(2-methylphenyl)-N-(5-methyl-2-pyridinyl)-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxamide |
|---|---|
| PubChem CID | 51650072 |
| Molecular Formula | C25H27N3O2 |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.21 |
| IUPAC Name | (4R,7R)-2,7-dimethyl-4-(2-methylphenyl)-N-(5-methyl-2-pyridinyl)-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxamide |
| SMILES | CC1=C(C(=O)Nc2ccc(C)cn2)[C@H](c2ccccc2C)C2=C(C[C@@H](C)CC2=O)N1 |
| InChI | InChI=1S/C25H27N3O2/c1-14-9-10-21(26-13-14)28-25(30)22-17(4)27-19-11-15(2)12-20(29)24(19)23(22)18-8-6-5-7-16(18)3/h5-10,13,15,23,27H,11-12H2,1-4H3,(H,26,28,30)/t15-,23+/m1/s1 |
| InChIKey | WNTQESCDHQYQQG-CMJOXMDJSA-N |
| XLogP | 4.55 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |