C19H20N2O7 — CID 51415295
[3-[(1R)-3-amino-2-nitro-7-oxo-1,4,5,6-tetrahydroinden-1-yl]phenyl] 2-methoxyethyl carbonate (PubChem CID 51415295) has the molecular formula C19H20N2O7 and a molecular weight of 388.38 g/mol. Its IUPAC name is [3-[(1R)-3-amino-2-nitro-7-oxo-1,4,5,6-tetrahydroinden-1-yl]phenyl] 2-methoxyethyl carbonate.
| Compound Name | [3-[(1R)-3-amino-2-nitro-7-oxo-1,4,5,6-tetrahydroinden-1-yl]phenyl] 2-methoxyethyl carbonate |
|---|---|
| PubChem CID | 51415295 |
| Molecular Formula | C19H20N2O7 |
| Molecular Weight | 388.38 g/mol |
| Exact Mass | 388.13 |
| IUPAC Name | [3-[(1R)-3-amino-2-nitro-7-oxo-1,4,5,6-tetrahydroinden-1-yl]phenyl] 2-methoxyethyl carbonate |
| SMILES | COCCOC(=O)Oc1cccc([C@@H]2C3=C(CCCC3=O)C(N)=C2[N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H20N2O7/c1-26-8-9-27-19(23)28-12-5-2-4-11(10-12)15-16-13(6-3-7-14(16)22)17(20)18(15)21(24)25/h2,4-5,10,15H,3,6-9,20H2,1H3/t15-/m1/s1 |
| InChIKey | XXUHCUGNYBRVRD-OAHLLOKOSA-N |
| XLogP | 2.44 |
| TPSA | 130.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.38 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|