C19H19F3N2O5S — CID 51419330
N-[(Z)-2-(4-tert-butylphenyl)sulfonyl-2-nitroethenyl]-4-(trifluoromethoxy)aniline (PubChem CID 51419330) has the molecular formula C19H19F3N2O5S and a molecular weight of 444.43 g/mol. Its IUPAC name is N-[(Z)-2-(4-tert-butylphenyl)sulfonyl-2-nitroethenyl]-4-(trifluoromethoxy)aniline.
| Compound Name | N-[(Z)-2-(4-tert-butylphenyl)sulfonyl-2-nitroethenyl]-4-(trifluoromethoxy)aniline |
|---|---|
| PubChem CID | 51419330 |
| Molecular Formula | C19H19F3N2O5S |
| Molecular Weight | 444.43 g/mol |
| Exact Mass | 444.10 |
| IUPAC Name | N-[(Z)-2-(4-tert-butylphenyl)sulfonyl-2-nitroethenyl]-4-(trifluoromethoxy)aniline |
| SMILES | CC(C)(C)c1ccc(S(=O)(=O)/C(=C\Nc2ccc(OC(F)(F)F)cc2)[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C19H19F3N2O5S/c1-18(2,3)13-4-10-16(11-5-13)30(27,28)17(24(25)26)12-23-14-6-8-15(9-7-14)29-19(20,21)22/h4-12,23H,1-3H3/b17-12- |
| InChIKey | ZMNPLBNHWMWNOC-ATVHPVEESA-N |
| XLogP | 4.84 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.43 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|