C24H26N6O3+2 — CID 51422797
6-amino-11-methyl-2-oxo-7-[[(2R)-oxolan-2-yl]methyl]-N-(pyridin-3-ylmethyl)-1-aza-7,9-diazoniatricyclo[8.4.0.03,8]tetradeca-3,5,7,9,11,13-hexaene-5-carboxamide (PubChem CID 51422797) has the molecular formula C24H26N6O3+2 and a molecular weight of 446.51 g/mol. Its IUPAC name is 6-amino-11-methyl-2-oxo-7-[[(2R)-oxolan-2-yl]methyl]-N-(pyridin-3-ylmethyl)-1-aza-7,9-diazoniatricyclo[8.4.0.03,8]tetradeca-3,5,7,9,11,13-hexaene-5-carboxamide.
| Compound Name | 6-amino-11-methyl-2-oxo-7-[[(2R)-oxolan-2-yl]methyl]-N-(pyridin-3-ylmethyl)-1-aza-7,9-diazoniatricyclo[8.4.0.03,8]tetradeca-3,5,7,9,11,13-hexaene-5-carboxamide |
|---|---|
| PubChem CID | 51422797 |
| Molecular Formula | C24H26N6O3+2 |
| Molecular Weight | 446.51 g/mol |
| Exact Mass | 446.21 |
| IUPAC Name | 6-amino-11-methyl-2-oxo-7-[[(2R)-oxolan-2-yl]methyl]-N-(pyridin-3-ylmethyl)-1-aza-7,9-diazoniatricyclo[8.4.0.03,8]tetradeca-3,5,7,9,11,13-hexaene-5-carboxamide |
| SMILES | Cc1cccn2c(=O)c3cc(C(=O)NCc4cccnc4)c(N)[n+](C[C@H]4CCCO4)c3[nH+]c12 |
| InChI | InChI=1S/C24H24N6O3/c1-15-5-3-9-29-21(15)28-22-19(24(29)32)11-18(20(25)30(22)14-17-7-4-10-33-17)23(31)27-13-16-6-2-8-26-12-16/h2-3,5-6,8-9,11-12,17,25H,4,7,10,13-14H2,1H3,(H,27,31)/p+2/t17-/m1/s1 |
| InChIKey | XPXWHWPEIBBBCJ-QGZVFWFLSA-P |
| XLogP | 0.95 |
| TPSA | 116.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.51 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|