C15H11NO4 — CID 5142646
6-ethyl-4,5-dioxopyrano[3,2-c]quinoline-3-carbaldehyde (PubChem CID 5142646) has the molecular formula C15H11NO4 and a molecular weight of 269.26 g/mol. Its IUPAC name is 6-ethyl-4,5-dioxopyrano[3,2-c]quinoline-3-carbaldehyde.
| Compound Name | 6-ethyl-4,5-dioxopyrano[3,2-c]quinoline-3-carbaldehyde |
|---|---|
| PubChem CID | 5142646 |
| Molecular Formula | C15H11NO4 |
| Molecular Weight | 269.26 g/mol |
| Exact Mass | 269.07 |
| IUPAC Name | 6-ethyl-4,5-dioxopyrano[3,2-c]quinoline-3-carbaldehyde |
| SMILES | CCn1c(=O)c2c(=O)c(C=O)coc2c2ccccc21 |
| InChI | InChI=1S/C15H11NO4/c1-2-16-11-6-4-3-5-10(11)14-12(15(16)19)13(18)9(7-17)8-20-14/h3-8H,2H2,1H3 |
| InChIKey | WZRHCOHBPYIVSO-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 69.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.26 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|