C20H19BrN2O2 — CID 514280
2-(5-bromo-2-pyridinyl)-3-cyclopentyl-1-methylindole-6-carboxylic acid (PubChem CID 514280) has the molecular formula C20H19BrN2O2 and a molecular weight of 399.29 g/mol. Its IUPAC name is 2-(5-bromo-2-pyridinyl)-3-cyclopentyl-1-methylindole-6-carboxylic acid.
| Compound Name | 2-(5-bromo-2-pyridinyl)-3-cyclopentyl-1-methylindole-6-carboxylic acid |
|---|---|
| PubChem CID | 514280 |
| Molecular Formula | C20H19BrN2O2 |
| Molecular Weight | 399.29 g/mol |
| Exact Mass | 398.06 |
| IUPAC Name | 2-(5-bromo-2-pyridinyl)-3-cyclopentyl-1-methylindole-6-carboxylic acid |
| SMILES | Cn1c(-c2ccc(Br)cn2)c(C2CCCC2)c2ccc(C(=O)O)cc21 |
| InChI | InChI=1S/C20H19BrN2O2/c1-23-17-10-13(20(24)25)6-8-15(17)18(12-4-2-3-5-12)19(23)16-9-7-14(21)11-22-16/h6-12H,2-5H2,1H3,(H,24,25) |
| InChIKey | BEYRQPUUFFSUKX-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.29 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|