C14H16ClN4O+ — CID 5143045
[(3-carbamoyl-2,6-dimethyl-4-pyridinyl)amino]-(4-chlorophenyl)azanium (PubChem CID 5143045) has the molecular formula C14H16ClN4O+ and a molecular weight of 291.76 g/mol. Its IUPAC name is [(3-carbamoyl-2,6-dimethyl-4-pyridinyl)amino]-(4-chlorophenyl)azanium.
| Compound Name | [(3-carbamoyl-2,6-dimethyl-4-pyridinyl)amino]-(4-chlorophenyl)azanium |
|---|---|
| PubChem CID | 5143045 |
| Molecular Formula | C14H16ClN4O+ |
| Molecular Weight | 291.76 g/mol |
| Exact Mass | 291.10 |
| IUPAC Name | [(3-carbamoyl-2,6-dimethyl-4-pyridinyl)amino]-(4-chlorophenyl)azanium |
| SMILES | Cc1cc(N[NH2+]c2ccc(Cl)cc2)c(C(N)=O)c(C)n1 |
| InChI | InChI=1S/C14H15ClN4O/c1-8-7-12(13(14(16)20)9(2)17-8)19-18-11-5-3-10(15)4-6-11/h3-7,18H,1-2H3,(H2,16,20)(H,17,19)/p+1 |
| InChIKey | DIBJHAGKNNKESV-UHFFFAOYSA-O |
| XLogP | 1.67 |
| TPSA | 84.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.76 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|