C26H30N4O5 — CID 51452623
(2'S,5S)-1-benzyl-1'-butyl-6'-nitro-2'-propylspiro[1,3-diazinane-5,3'-2,4-dihydroquinoline]-2,4,6-trione (PubChem CID 51452623) has the molecular formula C26H30N4O5 and a molecular weight of 478.55 g/mol. Its IUPAC name is (2'S,5S)-1-benzyl-1'-butyl-6'-nitro-2'-propylspiro[1,3-diazinane-5,3'-2,4-dihydroquinoline]-2,4,6-trione.
| Compound Name | (2'S,5S)-1-benzyl-1'-butyl-6'-nitro-2'-propylspiro[1,3-diazinane-5,3'-2,4-dihydroquinoline]-2,4,6-trione |
|---|---|
| PubChem CID | 51452623 |
| Molecular Formula | C26H30N4O5 |
| Molecular Weight | 478.55 g/mol |
| Exact Mass | 478.22 |
| IUPAC Name | (2'S,5S)-1-benzyl-1'-butyl-6'-nitro-2'-propylspiro[1,3-diazinane-5,3'-2,4-dihydroquinoline]-2,4,6-trione |
| SMILES | CCCCN1c2ccc([N+](=O)[O-])cc2C[C@@]2(C(=O)NC(=O)N(Cc3ccccc3)C2=O)[C@@H]1CCC |
| InChI | InChI=1S/C26H30N4O5/c1-3-5-14-28-21-13-12-20(30(34)35)15-19(21)16-26(22(28)9-4-2)23(31)27-25(33)29(24(26)32)17-18-10-7-6-8-11-18/h6-8,10-13,15,22H,3-5,9,14,16-17H2,1-2H3,(H,27,31,33)/t22-,26-/m0/s1 |
| InChIKey | FXMQFUVZDQRIIR-NVQXNPDNSA-N |
| XLogP | 4.19 |
| TPSA | 112.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.55 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|