C27H32N4O5 — CID 98693435
(2'R,5R)-1'-butyl-1-(3,5-dimethylphenyl)-6'-nitro-2'-propylspiro[1,3-diazinane-5,3'-2,4-dihydroquinoline]-2,4,6-trione (PubChem CID 98693435) has the molecular formula C27H32N4O5 and a molecular weight of 492.58 g/mol. Its IUPAC name is (2'R,5R)-1'-butyl-1-(3,5-dimethylphenyl)-6'-nitro-2'-propylspiro[1,3-diazinane-5,3'-2,4-dihydroquinoline]-2,4,6-trione.
| Compound Name | (2'R,5R)-1'-butyl-1-(3,5-dimethylphenyl)-6'-nitro-2'-propylspiro[1,3-diazinane-5,3'-2,4-dihydroquinoline]-2,4,6-trione |
|---|---|
| PubChem CID | 98693435 |
| Molecular Formula | C27H32N4O5 |
| Molecular Weight | 492.58 g/mol |
| Exact Mass | 492.24 |
| IUPAC Name | (2'R,5R)-1'-butyl-1-(3,5-dimethylphenyl)-6'-nitro-2'-propylspiro[1,3-diazinane-5,3'-2,4-dihydroquinoline]-2,4,6-trione |
| SMILES | CCCCN1c2ccc([N+](=O)[O-])cc2C[C@]2(C(=O)NC(=O)N(c3cc(C)cc(C)c3)C2=O)[C@H]1CCC |
| InChI | InChI=1S/C27H32N4O5/c1-5-7-11-29-22-10-9-20(31(35)36)15-19(22)16-27(23(29)8-6-2)24(32)28-26(34)30(25(27)33)21-13-17(3)12-18(4)14-21/h9-10,12-15,23H,5-8,11,16H2,1-4H3,(H,28,32,34)/t23-,27-/m1/s1 |
| InChIKey | QFGSOVFGTYDQQW-YIXXDRMTSA-N |
| XLogP | 4.81 |
| TPSA | 112.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.58 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|