C20H19Cl2N3O3 — CID 5145514
[2-(3,4-dichlorophenyl)-1-[2-(dimethylazaniumyl)ethyl]-4,5-dioxopyrrolidin-3-ylidene]-pyridin-4-ylmethanolate (PubChem CID 5145514) has the molecular formula C20H19Cl2N3O3 and a molecular weight of 420.30 g/mol. Its IUPAC name is [2-(3,4-dichlorophenyl)-1-[2-(dimethylazaniumyl)ethyl]-4,5-dioxopyrrolidin-3-ylidene]-pyridin-4-ylmethanolate.
| Compound Name | [2-(3,4-dichlorophenyl)-1-[2-(dimethylazaniumyl)ethyl]-4,5-dioxopyrrolidin-3-ylidene]-pyridin-4-ylmethanolate |
|---|---|
| PubChem CID | 5145514 |
| Molecular Formula | C20H19Cl2N3O3 |
| Molecular Weight | 420.30 g/mol |
| Exact Mass | 419.08 |
| IUPAC Name | [2-(3,4-dichlorophenyl)-1-[2-(dimethylazaniumyl)ethyl]-4,5-dioxopyrrolidin-3-ylidene]-pyridin-4-ylmethanolate |
| SMILES | C[NH+](C)CCN1C(=O)C(=O)C(=C([O-])c2ccncc2)C1c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C20H19Cl2N3O3/c1-24(2)9-10-25-17(13-3-4-14(21)15(22)11-13)16(19(27)20(25)28)18(26)12-5-7-23-8-6-12/h3-8,11,17,26H,9-10H2,1-2H3 |
| InChIKey | GTEYBQCTPLJDNJ-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 77.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.30 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|