C26H30Cl2N2O4 — CID 6053993
(E)-(4-butoxy-3-methylphenyl)-[2-(3,4-dichlorophenyl)-1-[2-(dimethylazaniumyl)ethyl]-4,5-dioxopyrrolidin-3-ylidene]methanolate (PubChem CID 6053993) has the molecular formula C26H30Cl2N2O4 and a molecular weight of 505.44 g/mol. Its IUPAC name is (E)-(4-butoxy-3-methylphenyl)-[2-(3,4-dichlorophenyl)-1-[2-(dimethylazaniumyl)ethyl]-4,5-dioxopyrrolidin-3-ylidene]methanolate.
| Compound Name | (E)-(4-butoxy-3-methylphenyl)-[2-(3,4-dichlorophenyl)-1-[2-(dimethylazaniumyl)ethyl]-4,5-dioxopyrrolidin-3-ylidene]methanolate |
|---|---|
| PubChem CID | 6053993 |
| Molecular Formula | C26H30Cl2N2O4 |
| Molecular Weight | 505.44 g/mol |
| Exact Mass | 504.16 |
| IUPAC Name | (E)-(4-butoxy-3-methylphenyl)-[2-(3,4-dichlorophenyl)-1-[2-(dimethylazaniumyl)ethyl]-4,5-dioxopyrrolidin-3-ylidene]methanolate |
| SMILES | CCCCOc1ccc(/C([O-])=C2\C(=O)C(=O)N(CC[NH+](C)C)C2c2ccc(Cl)c(Cl)c2)cc1C |
| InChI | InChI=1S/C26H30Cl2N2O4/c1-5-6-13-34-21-10-8-18(14-16(21)2)24(31)22-23(17-7-9-19(27)20(28)15-17)30(12-11-29(3)4)26(33)25(22)32/h7-10,14-15,23,31H,5-6,11-13H2,1-4H3/b24-22+ |
| InChIKey | VFUPRKIEELZDHI-ZNTNEXAZSA-N |
| XLogP | 2.85 |
| TPSA | 74.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.44 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|