C20H21N3O5 — CID 51462314
[(2R)-1-(furan-2-ylmethylamino)-1-oxopropan-2-yl] 4-oxo-3-propylphthalazine-1-carboxylate (PubChem CID 51462314) has the molecular formula C20H21N3O5 and a molecular weight of 383.40 g/mol. Its IUPAC name is [(2R)-1-(furan-2-ylmethylamino)-1-oxopropan-2-yl] 4-oxo-3-propylphthalazine-1-carboxylate.
| Compound Name | [(2R)-1-(furan-2-ylmethylamino)-1-oxopropan-2-yl] 4-oxo-3-propylphthalazine-1-carboxylate |
|---|---|
| PubChem CID | 51462314 |
| Molecular Formula | C20H21N3O5 |
| Molecular Weight | 383.40 g/mol |
| Exact Mass | 383.15 |
| IUPAC Name | [(2R)-1-(furan-2-ylmethylamino)-1-oxopropan-2-yl] 4-oxo-3-propylphthalazine-1-carboxylate |
| SMILES | CCCn1nc(C(=O)O[C@H](C)C(=O)NCc2ccco2)c2ccccc2c1=O |
| InChI | InChI=1S/C20H21N3O5/c1-3-10-23-19(25)16-9-5-4-8-15(16)17(22-23)20(26)28-13(2)18(24)21-12-14-7-6-11-27-14/h4-9,11,13H,3,10,12H2,1-2H3,(H,21,24)/t13-/m1/s1 |
| InChIKey | VSKHSWNEPLUKGC-CYBMUJFWSA-N |
| XLogP | 2.26 |
| TPSA | 103.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.40 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |