C24H24N2O5 — CID 51471014
2-[2-[(2R)-2-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)pyrrolidin-1-yl]-2-oxoethyl]-4H-isoquinoline-1,3-dione (PubChem CID 51471014) has the molecular formula C24H24N2O5 and a molecular weight of 420.47 g/mol. Its IUPAC name is 2-[2-[(2R)-2-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)pyrrolidin-1-yl]-2-oxoethyl]-4H-isoquinoline-1,3-dione.
| Compound Name | 2-[2-[(2R)-2-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)pyrrolidin-1-yl]-2-oxoethyl]-4H-isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 51471014 |
| Molecular Formula | C24H24N2O5 |
| Molecular Weight | 420.47 g/mol |
| Exact Mass | 420.17 |
| IUPAC Name | 2-[2-[(2R)-2-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)pyrrolidin-1-yl]-2-oxoethyl]-4H-isoquinoline-1,3-dione |
| SMILES | O=C1Cc2ccccc2C(=O)N1CC(=O)N1CCC[C@@H]1c1ccc2c(c1)OCCCO2 |
| InChI | InChI=1S/C24H24N2O5/c27-22-14-16-5-1-2-6-18(16)24(29)26(22)15-23(28)25-10-3-7-19(25)17-8-9-20-21(13-17)31-12-4-11-30-20/h1-2,5-6,8-9,13,19H,3-4,7,10-12,14-15H2/t19-/m1/s1 |
| InChIKey | SCJFIDAJFOBQAK-LJQANCHMSA-N |
| XLogP | 2.74 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.47 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|