C24H29N3O6 — CID 55546886
1-cyclohexyl-3-[2-[2-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)pyrrolidin-1-yl]-2-oxoethyl]imidazolidine-2,4,5-trione (PubChem CID 55546886) has the molecular formula C24H29N3O6 and a molecular weight of 455.51 g/mol. Its IUPAC name is 1-cyclohexyl-3-[2-[2-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)pyrrolidin-1-yl]-2-oxoethyl]imidazolidine-2,4,5-trione.
| Compound Name | 1-cyclohexyl-3-[2-[2-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)pyrrolidin-1-yl]-2-oxoethyl]imidazolidine-2,4,5-trione |
|---|---|
| PubChem CID | 55546886 |
| Molecular Formula | C24H29N3O6 |
| Molecular Weight | 455.51 g/mol |
| Exact Mass | 455.21 |
| IUPAC Name | 1-cyclohexyl-3-[2-[2-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)pyrrolidin-1-yl]-2-oxoethyl]imidazolidine-2,4,5-trione |
| SMILES | O=C1C(=O)N(C2CCCCC2)C(=O)N1CC(=O)N1CCCC1c1ccc2c(c1)OCCCO2 |
| InChI | InChI=1S/C24H29N3O6/c28-21(15-26-22(29)23(30)27(24(26)31)17-6-2-1-3-7-17)25-11-4-8-18(25)16-9-10-19-20(14-16)33-13-5-12-32-19/h9-10,14,17-18H,1-8,11-13,15H2 |
| InChIKey | QIRQHCPOLNVCPJ-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 96.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.51 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|