C21H17NO5 — CID 5147603
dibenzofuran-2-yl N-(3,4-dimethoxyphenyl)carbamate (PubChem CID 5147603) has the molecular formula C21H17NO5 and a molecular weight of 363.37 g/mol. Its IUPAC name is dibenzofuran-2-yl N-(3,4-dimethoxyphenyl)carbamate.
| Compound Name | dibenzofuran-2-yl N-(3,4-dimethoxyphenyl)carbamate |
|---|---|
| PubChem CID | 5147603 |
| Molecular Formula | C21H17NO5 |
| Molecular Weight | 363.37 g/mol |
| Exact Mass | 363.11 |
| IUPAC Name | dibenzofuran-2-yl N-(3,4-dimethoxyphenyl)carbamate |
| SMILES | COc1ccc(NC(=O)Oc2ccc3oc4ccccc4c3c2)cc1OC |
| InChI | InChI=1S/C21H17NO5/c1-24-19-9-7-13(11-20(19)25-2)22-21(23)26-14-8-10-18-16(12-14)15-5-3-4-6-17(15)27-18/h3-12H,1-2H3,(H,22,23) |
| InChIKey | NFCGGFRRLAPYBU-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 69.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.37 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |