C15H16FN3O2 — CID 51487794
[3-(4-fluorophenyl)imidazol-4-yl]-[(2S)-2-methylmorpholin-4-yl]methanone (PubChem CID 51487794) has the molecular formula C15H16FN3O2 and a molecular weight of 289.31 g/mol. Its IUPAC name is [3-(4-fluorophenyl)imidazol-4-yl]-[(2S)-2-methylmorpholin-4-yl]methanone.
| Compound Name | [3-(4-fluorophenyl)imidazol-4-yl]-[(2S)-2-methylmorpholin-4-yl]methanone |
|---|---|
| PubChem CID | 51487794 |
| Molecular Formula | C15H16FN3O2 |
| Molecular Weight | 289.31 g/mol |
| Exact Mass | 289.12 |
| IUPAC Name | [3-(4-fluorophenyl)imidazol-4-yl]-[(2S)-2-methylmorpholin-4-yl]methanone |
| SMILES | C[C@H]1CN(C(=O)c2cncn2-c2ccc(F)cc2)CCO1 |
| InChI | InChI=1S/C15H16FN3O2/c1-11-9-18(6-7-21-11)15(20)14-8-17-10-19(14)13-4-2-12(16)3-5-13/h2-5,8,10-11H,6-7,9H2,1H3/t11-/m0/s1 |
| InChIKey | WGUNGTOMZOCVNM-NSHDSACASA-N |
| XLogP | 1.87 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.31 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |