About [3-[4-(3,5-dimethylphenyl)phenyl]imidazol-4-yl]-[(3R)-3-methylpiperidin-1-yl]methanone
[3-[4-(3,5-dimethylphenyl)phenyl]imidazol-4-yl]-[(3R)-3-methylpiperidin-1-yl]methanone (PubChem CID 92767524) has the molecular formula C24H27N3O
and a molecular weight of 373.50 g/mol. Its IUPAC name is [3-[4-(3,5-dimethylphenyl)phenyl]imidazol-4-yl]-[(3R)-3-methylpiperidin-1-yl]methanone.
Molecular Properties
| Compound Name | [3-[4-(3,5-dimethylphenyl)phenyl]imidazol-4-yl]-[(3R)-3-methylpiperidin-1-yl]methanone |
| PubChem CID | 92767524 |
| Molecular Formula | C24H27N3O |
| Molecular Weight | 373.50 g/mol |
| Exact Mass | 373.22 |
| IUPAC Name | [3-[4-(3,5-dimethylphenyl)phenyl]imidazol-4-yl]-[(3R)-3-methylpiperidin-1-yl]methanone |
| SMILES | Cc1cc(C)cc(-c2ccc(-n3cncc3C(=O)N3CCC[C@@H](C)C3)cc2)c1 |
| InChI | InChI=1S/C24H27N3O/c1-17-5-4-10-26(15-17)24(28)23-14-25-16-27(23)22-8-6-20(7-9-22)21-12-18(2)11-19(3)13-21/h6-9,11-14,16-17H,4-5,10,15H2,1-3H3/t17-/m1/s1 |
| InChIKey | DMISADZAQLNHLI-QGZVFWFLSA-N |
| XLogP | 5.03 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 373.50 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [3-[4-(3,5-dimethylphenyl)phenyl]imidazol-4-yl]-[(3R)-3-methylpiperidin-1-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[4-(3,5-dimethylphenyl)phenyl]imidazol-4-yl]-[(3R)-3-methylpiperidin-1-yl]methanone?
The IUPAC name of [3-[4-(3,5-dimethylphenyl)phenyl]imidazol-4-yl]-[(3R)-3-methylpiperidin-1-yl]methanone (CID 92767524) is [3-[4-(3,5-dimethylphenyl)phenyl]imidazol-4-yl]-[(3R)-3-methylpiperidin-1-yl]methanone.
What is the SMILES notation for [3-[4-(3,5-dimethylphenyl)phenyl]imidazol-4-yl]-[(3R)-3-methylpiperidin-1-yl]methanone?
The canonical SMILES for [3-[4-(3,5-dimethylphenyl)phenyl]imidazol-4-yl]-[(3R)-3-methylpiperidin-1-yl]methanone is Cc1cc(C)cc(-c2ccc(-n3cncc3C(=O)N3CCC[C@@H](C)C3)cc2)c1.
What is the InChIKey of [3-[4-(3,5-dimethylphenyl)phenyl]imidazol-4-yl]-[(3R)-3-methylpiperidin-1-yl]methanone?
The InChIKey is DMISADZAQLNHLI-QGZVFWFLSA-N. The full InChI is InChI=1S/C24H27N3O/c1-17-5-4-10-26(15-17)24(28)23-14-25-16-27(23)22-8-6-20(7-9-22)21-12-18(2)11-19(3)13-21/h6-9,11-14,16-17H,4-5,10,15H2,1-3H3/t17-/m1/s1.
What are the key properties of [3-[4-(3,5-dimethylphenyl)phenyl]imidazol-4-yl]-[(3R)-3-methylpiperidin-1-yl]methanone?
[3-[4-(3,5-dimethylphenyl)phenyl]imidazol-4-yl]-[(3R)-3-methylpiperidin-1-yl]methanone has a molecular weight of 373.50 g/mol, XLogP of 5.03, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[4-(3,5-dimethylphenyl)phenyl]imidazol-4-yl]-[(3R)-3-methylpiperidin-1-yl]methanone is sourced from PubChem (CID 92767524), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).