C25H31N3O — CID 92767435
3-[4-(3,5-dimethylphenyl)phenyl]-N-[(2R)-heptan-2-yl]imidazole-4-carboxamide (PubChem CID 92767435) has the molecular formula C25H31N3O and a molecular weight of 389.54 g/mol. Its IUPAC name is 3-[4-(3,5-dimethylphenyl)phenyl]-N-[(2R)-heptan-2-yl]imidazole-4-carboxamide.
| Compound Name | 3-[4-(3,5-dimethylphenyl)phenyl]-N-[(2R)-heptan-2-yl]imidazole-4-carboxamide |
|---|---|
| PubChem CID | 92767435 |
| Molecular Formula | C25H31N3O |
| Molecular Weight | 389.54 g/mol |
| Exact Mass | 389.25 |
| IUPAC Name | 3-[4-(3,5-dimethylphenyl)phenyl]-N-[(2R)-heptan-2-yl]imidazole-4-carboxamide |
| SMILES | CCCCC[C@@H](C)NC(=O)c1cncn1-c1ccc(-c2cc(C)cc(C)c2)cc1 |
| InChI | InChI=1S/C25H31N3O/c1-5-6-7-8-20(4)27-25(29)24-16-26-17-28(24)23-11-9-21(10-12-23)22-14-18(2)13-19(3)15-22/h9-17,20H,5-8H2,1-4H3,(H,27,29)/t20-/m1/s1 |
| InChIKey | RAXLILSQUKGDOF-HXUWFJFHSA-N |
| XLogP | 5.85 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.54 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|