C24H29N3O — CID 92762304
N-[(2R)-5-methylhexan-2-yl]-3-[4-(2-methylphenyl)phenyl]imidazole-4-carboxamide (PubChem CID 92762304) has the molecular formula C24H29N3O and a molecular weight of 375.52 g/mol. Its IUPAC name is N-[(2R)-5-methylhexan-2-yl]-3-[4-(2-methylphenyl)phenyl]imidazole-4-carboxamide.
| Compound Name | N-[(2R)-5-methylhexan-2-yl]-3-[4-(2-methylphenyl)phenyl]imidazole-4-carboxamide |
|---|---|
| PubChem CID | 92762304 |
| Molecular Formula | C24H29N3O |
| Molecular Weight | 375.52 g/mol |
| Exact Mass | 375.23 |
| IUPAC Name | N-[(2R)-5-methylhexan-2-yl]-3-[4-(2-methylphenyl)phenyl]imidazole-4-carboxamide |
| SMILES | Cc1ccccc1-c1ccc(-n2cncc2C(=O)N[C@H](C)CCC(C)C)cc1 |
| InChI | InChI=1S/C24H29N3O/c1-17(2)9-10-19(4)26-24(28)23-15-25-16-27(23)21-13-11-20(12-14-21)22-8-6-5-7-18(22)3/h5-8,11-17,19H,9-10H2,1-4H3,(H,26,28)/t19-/m1/s1 |
| InChIKey | VMQFCMIRGXGECY-LJQANCHMSA-N |
| XLogP | 5.40 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.52 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |