C25H22BrN3O — CID 92773011
N-[(1S)-1-(4-bromophenyl)ethyl]-3-[4-(2-methylphenyl)phenyl]imidazole-4-carboxamide (PubChem CID 92773011) has the molecular formula C25H22BrN3O and a molecular weight of 460.38 g/mol. Its IUPAC name is N-[(1S)-1-(4-bromophenyl)ethyl]-3-[4-(2-methylphenyl)phenyl]imidazole-4-carboxamide.
| Compound Name | N-[(1S)-1-(4-bromophenyl)ethyl]-3-[4-(2-methylphenyl)phenyl]imidazole-4-carboxamide |
|---|---|
| PubChem CID | 92773011 |
| Molecular Formula | C25H22BrN3O |
| Molecular Weight | 460.38 g/mol |
| Exact Mass | 459.09 |
| IUPAC Name | N-[(1S)-1-(4-bromophenyl)ethyl]-3-[4-(2-methylphenyl)phenyl]imidazole-4-carboxamide |
| SMILES | Cc1ccccc1-c1ccc(-n2cncc2C(=O)N[C@@H](C)c2ccc(Br)cc2)cc1 |
| InChI | InChI=1S/C25H22BrN3O/c1-17-5-3-4-6-23(17)20-9-13-22(14-10-20)29-16-27-15-24(29)25(30)28-18(2)19-7-11-21(26)12-8-19/h3-16,18H,1-2H3,(H,28,30)/t18-/m0/s1 |
| InChIKey | KGVYZRPOONTZSN-SFHVURJKSA-N |
| XLogP | 6.10 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.38 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |