C23H25F2N3O — CID 46103182
3-[4-(3,4-difluorophenyl)phenyl]-N-heptan-4-ylimidazole-4-carboxamide (PubChem CID 46103182) has the molecular formula C23H25F2N3O and a molecular weight of 397.47 g/mol. Its IUPAC name is 3-[4-(3,4-difluorophenyl)phenyl]-N-heptan-4-ylimidazole-4-carboxamide.
| Compound Name | 3-[4-(3,4-difluorophenyl)phenyl]-N-heptan-4-ylimidazole-4-carboxamide |
|---|---|
| PubChem CID | 46103182 |
| Molecular Formula | C23H25F2N3O |
| Molecular Weight | 397.47 g/mol |
| Exact Mass | 397.20 |
| IUPAC Name | 3-[4-(3,4-difluorophenyl)phenyl]-N-heptan-4-ylimidazole-4-carboxamide |
| SMILES | CCCC(CCC)NC(=O)c1cncn1-c1ccc(-c2ccc(F)c(F)c2)cc1 |
| InChI | InChI=1S/C23H25F2N3O/c1-3-5-18(6-4-2)27-23(29)22-14-26-15-28(22)19-10-7-16(8-11-19)17-9-12-20(24)21(25)13-17/h7-15,18H,3-6H2,1-2H3,(H,27,29) |
| InChIKey | XXUPDKXJXFTTTJ-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.47 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |