C24H26F3N3O — CID 46081560
N-heptan-2-yl-3-[3-[2-(trifluoromethyl)phenyl]phenyl]imidazole-4-carboxamide (PubChem CID 46081560) has the molecular formula C24H26F3N3O and a molecular weight of 429.49 g/mol. Its IUPAC name is N-heptan-2-yl-3-[3-[2-(trifluoromethyl)phenyl]phenyl]imidazole-4-carboxamide.
| Compound Name | N-heptan-2-yl-3-[3-[2-(trifluoromethyl)phenyl]phenyl]imidazole-4-carboxamide |
|---|---|
| PubChem CID | 46081560 |
| Molecular Formula | C24H26F3N3O |
| Molecular Weight | 429.49 g/mol |
| Exact Mass | 429.20 |
| IUPAC Name | N-heptan-2-yl-3-[3-[2-(trifluoromethyl)phenyl]phenyl]imidazole-4-carboxamide |
| SMILES | CCCCCC(C)NC(=O)c1cncn1-c1cccc(-c2ccccc2C(F)(F)F)c1 |
| InChI | InChI=1S/C24H26F3N3O/c1-3-4-5-9-17(2)29-23(31)22-15-28-16-30(22)19-11-8-10-18(14-19)20-12-6-7-13-21(20)24(25,26)27/h6-8,10-17H,3-5,9H2,1-2H3,(H,29,31) |
| InChIKey | NDHKHTZALXZFLK-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.49 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|