C25H28F3N3O — CID 92769989
N-[(2R)-2-ethylhexyl]-3-[3-[2-(trifluoromethyl)phenyl]phenyl]imidazole-4-carboxamide (PubChem CID 92769989) has the molecular formula C25H28F3N3O and a molecular weight of 443.51 g/mol. Its IUPAC name is N-[(2R)-2-ethylhexyl]-3-[3-[2-(trifluoromethyl)phenyl]phenyl]imidazole-4-carboxamide.
| Compound Name | N-[(2R)-2-ethylhexyl]-3-[3-[2-(trifluoromethyl)phenyl]phenyl]imidazole-4-carboxamide |
|---|---|
| PubChem CID | 92769989 |
| Molecular Formula | C25H28F3N3O |
| Molecular Weight | 443.51 g/mol |
| Exact Mass | 443.22 |
| IUPAC Name | N-[(2R)-2-ethylhexyl]-3-[3-[2-(trifluoromethyl)phenyl]phenyl]imidazole-4-carboxamide |
| SMILES | CCCC[C@@H](CC)CNC(=O)c1cncn1-c1cccc(-c2ccccc2C(F)(F)F)c1 |
| InChI | InChI=1S/C25H28F3N3O/c1-3-5-9-18(4-2)15-30-24(32)23-16-29-17-31(23)20-11-8-10-19(14-20)21-12-6-7-13-22(21)25(26,27)28/h6-8,10-14,16-18H,3-5,9,15H2,1-2H3,(H,30,32)/t18-/m1/s1 |
| InChIKey | UDGDJJMGJHVKDJ-GOSISDBHSA-N |
| XLogP | 6.50 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.51 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |