C29H39N3O4 — CID 92771062
3-[3-(3,4-dimethoxyphenyl)phenyl]-N-[3-[(2S)-2-ethylhexoxy]propyl]imidazole-4-carboxamide (PubChem CID 92771062) has the molecular formula C29H39N3O4 and a molecular weight of 493.65 g/mol. Its IUPAC name is 3-[3-(3,4-dimethoxyphenyl)phenyl]-N-[3-[(2S)-2-ethylhexoxy]propyl]imidazole-4-carboxamide.
| Compound Name | 3-[3-(3,4-dimethoxyphenyl)phenyl]-N-[3-[(2S)-2-ethylhexoxy]propyl]imidazole-4-carboxamide |
|---|---|
| PubChem CID | 92771062 |
| Molecular Formula | C29H39N3O4 |
| Molecular Weight | 493.65 g/mol |
| Exact Mass | 493.29 |
| IUPAC Name | 3-[3-(3,4-dimethoxyphenyl)phenyl]-N-[3-[(2S)-2-ethylhexoxy]propyl]imidazole-4-carboxamide |
| SMILES | CCCC[C@H](CC)COCCCNC(=O)c1cncn1-c1cccc(-c2ccc(OC)c(OC)c2)c1 |
| InChI | InChI=1S/C29H39N3O4/c1-5-7-10-22(6-2)20-36-16-9-15-31-29(33)26-19-30-21-32(26)25-12-8-11-23(17-25)24-13-14-27(34-3)28(18-24)35-4/h8,11-14,17-19,21-22H,5-7,9-10,15-16,20H2,1-4H3,(H,31,33)/t22-/m0/s1 |
| InChIKey | OKKBYOQYPJERPR-QFIPXVFZSA-N |
| XLogP | 5.91 |
| TPSA | 74.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.65 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|