C32H27N3O2S — CID 46102881
3-(3-dibenzothiophen-4-ylphenyl)-N-[3-(4-methoxyphenyl)propyl]imidazole-4-carboxamide (PubChem CID 46102881) has the molecular formula C32H27N3O2S and a molecular weight of 517.65 g/mol. Its IUPAC name is 3-(3-dibenzothiophen-4-ylphenyl)-N-[3-(4-methoxyphenyl)propyl]imidazole-4-carboxamide.
| Compound Name | 3-(3-dibenzothiophen-4-ylphenyl)-N-[3-(4-methoxyphenyl)propyl]imidazole-4-carboxamide |
|---|---|
| PubChem CID | 46102881 |
| Molecular Formula | C32H27N3O2S |
| Molecular Weight | 517.65 g/mol |
| Exact Mass | 517.18 |
| IUPAC Name | 3-(3-dibenzothiophen-4-ylphenyl)-N-[3-(4-methoxyphenyl)propyl]imidazole-4-carboxamide |
| SMILES | COc1ccc(CCCNC(=O)c2cncn2-c2cccc(-c3cccc4c3sc3ccccc34)c2)cc1 |
| InChI | InChI=1S/C32H27N3O2S/c1-37-25-16-14-22(15-17-25)7-6-18-34-32(36)29-20-33-21-35(29)24-9-4-8-23(19-24)26-11-5-12-28-27-10-2-3-13-30(27)38-31(26)28/h2-5,8-17,19-21H,6-7,18H2,1H3,(H,34,36) |
| InChIKey | KHIVVZSTZWQBGP-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.65 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|