C27H19N3OS2 — CID 46101362
3-(3-dibenzothiophen-4-ylphenyl)-N-(thiophen-2-ylmethyl)imidazole-4-carboxamide (PubChem CID 46101362) has the molecular formula C27H19N3OS2 and a molecular weight of 465.60 g/mol. Its IUPAC name is 3-(3-dibenzothiophen-4-ylphenyl)-N-(thiophen-2-ylmethyl)imidazole-4-carboxamide.
| Compound Name | 3-(3-dibenzothiophen-4-ylphenyl)-N-(thiophen-2-ylmethyl)imidazole-4-carboxamide |
|---|---|
| PubChem CID | 46101362 |
| Molecular Formula | C27H19N3OS2 |
| Molecular Weight | 465.60 g/mol |
| Exact Mass | 465.10 |
| IUPAC Name | 3-(3-dibenzothiophen-4-ylphenyl)-N-(thiophen-2-ylmethyl)imidazole-4-carboxamide |
| SMILES | O=C(NCc1cccs1)c1cncn1-c1cccc(-c2cccc3c2sc2ccccc23)c1 |
| InChI | InChI=1S/C27H19N3OS2/c31-27(29-15-20-8-5-13-32-20)24-16-28-17-30(24)19-7-3-6-18(14-19)21-10-4-11-23-22-9-1-2-12-25(22)33-26(21)23/h1-14,16-17H,15H2,(H,29,31) |
| InChIKey | ISSSOZGEDSLMCD-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.60 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |