C24H17F3IN3O — CID 46081597
N-[(3-iodophenyl)methyl]-3-[3-[2-(trifluoromethyl)phenyl]phenyl]imidazole-4-carboxamide (PubChem CID 46081597) has the molecular formula C24H17F3IN3O and a molecular weight of 547.32 g/mol. Its IUPAC name is N-[(3-iodophenyl)methyl]-3-[3-[2-(trifluoromethyl)phenyl]phenyl]imidazole-4-carboxamide.
| Compound Name | N-[(3-iodophenyl)methyl]-3-[3-[2-(trifluoromethyl)phenyl]phenyl]imidazole-4-carboxamide |
|---|---|
| PubChem CID | 46081597 |
| Molecular Formula | C24H17F3IN3O |
| Molecular Weight | 547.32 g/mol |
| Exact Mass | 547.04 |
| IUPAC Name | N-[(3-iodophenyl)methyl]-3-[3-[2-(trifluoromethyl)phenyl]phenyl]imidazole-4-carboxamide |
| SMILES | O=C(NCc1cccc(I)c1)c1cncn1-c1cccc(-c2ccccc2C(F)(F)F)c1 |
| InChI | InChI=1S/C24H17F3IN3O/c25-24(26,27)21-10-2-1-9-20(21)17-6-4-8-19(12-17)31-15-29-14-22(31)23(32)30-13-16-5-3-7-18(28)11-16/h1-12,14-15H,13H2,(H,30,32) |
| InChIKey | SLZNHFNKMFZWQB-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.32 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|