C22H22F3N3O2 — CID 46081579
N-(1-methoxybutan-2-yl)-3-[3-[2-(trifluoromethyl)phenyl]phenyl]imidazole-4-carboxamide (PubChem CID 46081579) has the molecular formula C22H22F3N3O2 and a molecular weight of 417.43 g/mol. Its IUPAC name is N-(1-methoxybutan-2-yl)-3-[3-[2-(trifluoromethyl)phenyl]phenyl]imidazole-4-carboxamide.
| Compound Name | N-(1-methoxybutan-2-yl)-3-[3-[2-(trifluoromethyl)phenyl]phenyl]imidazole-4-carboxamide |
|---|---|
| PubChem CID | 46081579 |
| Molecular Formula | C22H22F3N3O2 |
| Molecular Weight | 417.43 g/mol |
| Exact Mass | 417.17 |
| IUPAC Name | N-(1-methoxybutan-2-yl)-3-[3-[2-(trifluoromethyl)phenyl]phenyl]imidazole-4-carboxamide |
| SMILES | CCC(COC)NC(=O)c1cncn1-c1cccc(-c2ccccc2C(F)(F)F)c1 |
| InChI | InChI=1S/C22H22F3N3O2/c1-3-16(13-30-2)27-21(29)20-12-26-14-28(20)17-8-6-7-15(11-17)18-9-4-5-10-19(18)22(23,24)25/h4-12,14,16H,3,13H2,1-2H3,(H,27,29) |
| InChIKey | FNXHAXKQUKSBNO-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.43 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |