C31H27N3O4 — CID 46103109
N-[2-(4-methoxyphenoxy)ethyl]-3-[3-(4-phenoxyphenyl)phenyl]imidazole-4-carboxamide (PubChem CID 46103109) has the molecular formula C31H27N3O4 and a molecular weight of 505.57 g/mol. Its IUPAC name is N-[2-(4-methoxyphenoxy)ethyl]-3-[3-(4-phenoxyphenyl)phenyl]imidazole-4-carboxamide.
| Compound Name | N-[2-(4-methoxyphenoxy)ethyl]-3-[3-(4-phenoxyphenyl)phenyl]imidazole-4-carboxamide |
|---|---|
| PubChem CID | 46103109 |
| Molecular Formula | C31H27N3O4 |
| Molecular Weight | 505.57 g/mol |
| Exact Mass | 505.20 |
| IUPAC Name | N-[2-(4-methoxyphenoxy)ethyl]-3-[3-(4-phenoxyphenyl)phenyl]imidazole-4-carboxamide |
| SMILES | COc1ccc(OCCNC(=O)c2cncn2-c2cccc(-c3ccc(Oc4ccccc4)cc3)c2)cc1 |
| InChI | InChI=1S/C31H27N3O4/c1-36-26-14-16-27(17-15-26)37-19-18-33-31(35)30-21-32-22-34(30)25-7-5-6-24(20-25)23-10-12-29(13-11-23)38-28-8-3-2-4-9-28/h2-17,20-22H,18-19H2,1H3,(H,33,35) |
| InChIKey | HUQBZBHHMWCGEW-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 74.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.57 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|