C35H52N2O10 — CID 5149031
ethyl N-[4-hydroxy-15,16-bis(4-hydroxybutyl)-12-methoxyimino-9-prop-2-enoxy-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-2(7),3,5,13-tetraen-10-yl]-N-[2-(2-hydroxyethoxy)ethyl]carbamate (PubChem CID 5149031) has the molecular formula C35H52N2O10 and a molecular weight of 660.81 g/mol. Its IUPAC name is ethyl N-[4-hydroxy-15,16-bis(4-hydroxybutyl)-12-methoxyimino-9-prop-2-enoxy-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-2(7),3,5,13-tetraen-10-yl]-N-[2-(2-hydroxyethoxy)ethyl]carbamate.
| Compound Name | ethyl N-[4-hydroxy-15,16-bis(4-hydroxybutyl)-12-methoxyimino-9-prop-2-enoxy-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-2(7),3,5,13-tetraen-10-yl]-N-[2-(2-hydroxyethoxy)ethyl]carbamate |
|---|---|
| PubChem CID | 5149031 |
| Molecular Formula | C35H52N2O10 |
| Molecular Weight | 660.81 g/mol |
| Exact Mass | 660.36 |
| IUPAC Name | ethyl N-[4-hydroxy-15,16-bis(4-hydroxybutyl)-12-methoxyimino-9-prop-2-enoxy-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-2(7),3,5,13-tetraen-10-yl]-N-[2-(2-hydroxyethoxy)ethyl]carbamate |
| SMILES | C=CCOC12Oc3ccc(O)cc3C3C(CCCCO)C(CCCCO)C=C(C(=NOC)CC1N(CCOCCO)C(=O)OCC)C32 |
| InChI | InChI=1S/C35H52N2O10/c1-4-18-46-35-31(37(34(42)45-5-2)14-19-44-20-17-40)23-29(36-43-3)27-21-24(10-6-8-15-38)26(11-7-9-16-39)32(33(27)35)28-22-25(41)12-13-30(28)47-35/h4,12-13,21-22,24,26,31-33,38-41H,1,5-11,14-20,23H2,2-3H3 |
| InChIKey | VBDHJNFDTPXFFS-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 159.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.81 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|