C39H58N2O11 — CID 5149022
ethyl N-[4-hydroxy-15,16-bis(4-hydroxybutyl)-12-(oxan-2-yloxyimino)-9-prop-2-enoxy-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-2(7),3,5,13-tetraen-10-yl]-N-[2-(2-hydroxyethoxy)ethyl]carbamate (PubChem CID 5149022) has the molecular formula C39H58N2O11 and a molecular weight of 730.90 g/mol. Its IUPAC name is ethyl N-[4-hydroxy-15,16-bis(4-hydroxybutyl)-12-(oxan-2-yloxyimino)-9-prop-2-enoxy-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-2(7),3,5,13-tetraen-10-yl]-N-[2-(2-hydroxyethoxy)ethyl]carbamate.
| Compound Name | ethyl N-[4-hydroxy-15,16-bis(4-hydroxybutyl)-12-(oxan-2-yloxyimino)-9-prop-2-enoxy-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-2(7),3,5,13-tetraen-10-yl]-N-[2-(2-hydroxyethoxy)ethyl]carbamate |
|---|---|
| PubChem CID | 5149022 |
| Molecular Formula | C39H58N2O11 |
| Molecular Weight | 730.90 g/mol |
| Exact Mass | 730.40 |
| IUPAC Name | ethyl N-[4-hydroxy-15,16-bis(4-hydroxybutyl)-12-(oxan-2-yloxyimino)-9-prop-2-enoxy-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-2(7),3,5,13-tetraen-10-yl]-N-[2-(2-hydroxyethoxy)ethyl]carbamate |
| SMILES | C=CCOC12Oc3ccc(O)cc3C3C(CCCCO)C(CCCCO)C=C(C(=NOC4CCCCO4)CC1N(CCOCCO)C(=O)OCC)C32 |
| InChI | InChI=1S/C39H58N2O11/c1-3-20-50-39-34(41(38(46)48-4-2)16-22-47-23-19-44)26-32(40-52-35-13-7-10-21-49-35)30-24-27(11-5-8-17-42)29(12-6-9-18-43)36(37(30)39)31-25-28(45)14-15-33(31)51-39/h3,14-15,24-25,27,29,34-37,42-45H,1,4-13,16-23,26H2,2H3 |
| InChIKey | ZRXOMLSBTIJHEW-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 168.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 730.90 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|