C37H52N2O8 — CID 3658711
N-[4-hydroxy-15,16-bis(4-hydroxybutyl)-12-(oxan-2-yloxyimino)-9-prop-2-enoxy-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-2(7),3,5,13-tetraen-10-yl]-N-methylcyclopropanecarboxamide (PubChem CID 3658711) has the molecular formula C37H52N2O8 and a molecular weight of 652.83 g/mol. Its IUPAC name is N-[4-hydroxy-15,16-bis(4-hydroxybutyl)-12-(oxan-2-yloxyimino)-9-prop-2-enoxy-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-2(7),3,5,13-tetraen-10-yl]-N-methylcyclopropanecarboxamide.
| Compound Name | N-[4-hydroxy-15,16-bis(4-hydroxybutyl)-12-(oxan-2-yloxyimino)-9-prop-2-enoxy-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-2(7),3,5,13-tetraen-10-yl]-N-methylcyclopropanecarboxamide |
|---|---|
| PubChem CID | 3658711 |
| Molecular Formula | C37H52N2O8 |
| Molecular Weight | 652.83 g/mol |
| Exact Mass | 652.37 |
| IUPAC Name | N-[4-hydroxy-15,16-bis(4-hydroxybutyl)-12-(oxan-2-yloxyimino)-9-prop-2-enoxy-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-2(7),3,5,13-tetraen-10-yl]-N-methylcyclopropanecarboxamide |
| SMILES | C=CCOC12Oc3ccc(O)cc3C3C(CCCCO)C(CCCCO)C=C(C(=NOC4CCCCO4)CC1N(C)C(=O)C1CC1)C32 |
| InChI | InChI=1S/C37H52N2O8/c1-3-19-45-37-32(39(2)36(43)24-13-14-24)23-30(38-47-33-12-6-9-20-44-33)28-21-25(10-4-7-17-40)27(11-5-8-18-41)34(35(28)37)29-22-26(42)15-16-31(29)46-37/h3,15-16,21-22,24-25,27,32-35,40-42H,1,4-14,17-20,23H2,2H3 |
| InChIKey | LWOUJLIPLIHTJJ-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 130.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.83 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|